C5H8N4S — CID 158488916
2-amino-4-methyl-1,3-thiazole-5-carboximidamide (PubChem CID 158488916) has the molecular formula C5H8N4S and a molecular weight of 156.21 g/mol. Its IUPAC name is 2-amino-4-methyl-1,3-thiazole-5-carboximidamide.
| Compound Name | 2-amino-4-methyl-1,3-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 158488916 |
| Molecular Formula | C5H8N4S |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 2-amino-4-methyl-1,3-thiazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1sc(N)nc1C |
| InChI | InChI=1S/C5H8N4S/c1-2-3(4(6)7)10-5(8)9-2/h1H3,(H3,6,7)(H2,8,9) |
| InChIKey | HDBQLIBEHJNMOP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|