C6H9N3OS — CID 45058673
2-amino-N,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 45058673) has the molecular formula C6H9N3OS and a molecular weight of 171.22 g/mol. Its IUPAC name is 2-amino-N,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N,4-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 45058673 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 2-amino-N,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)c1sc(N)nc1C |
| InChI | InChI=1S/C6H9N3OS/c1-3-4(5(10)8-2)11-6(7)9-3/h1-2H3,(H2,7,9)(H,8,10) |
| InChIKey | NHTFMXNKBMJNCP-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |