C7H11N3OS — CID 673715
2-amino-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 673715) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is 2-amino-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 673715 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 2-amino-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(N)sc1C(=O)N(C)C |
| InChI | InChI=1S/C7H11N3OS/c1-4-5(6(11)10(2)3)12-7(8)9-4/h1-3H3,(H2,8,9) |
| InChIKey | DVJPMCANMMJVQH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |