C15H17N3O2S — CID 82066992
2-[2-(4-aminophenyl)-2-oxoethyl]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 82066992) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)-2-oxoethyl]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[2-(4-aminophenyl)-2-oxoethyl]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 82066992 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-[2-(4-aminophenyl)-2-oxoethyl]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(CC(=O)c2ccc(N)cc2)sc1C(=O)N(C)C |
| InChI | InChI=1S/C15H17N3O2S/c1-9-14(15(20)18(2)3)21-13(17-9)8-12(19)10-4-6-11(16)7-5-10/h4-7H,8,16H2,1-3H3 |
| InChIKey | KJDDNMTXHXRELO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|