C19H19NO4S — CID 161431009
prop-2-enyl 4-methyl-2-[2-oxo-2-[4-(2-oxopropyl)phenyl]ethyl]-1,3-thiazole-5-carboxylate (PubChem CID 161431009) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is prop-2-enyl 4-methyl-2-[2-oxo-2-[4-(2-oxopropyl)phenyl]ethyl]-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 4-methyl-2-[2-oxo-2-[4-(2-oxopropyl)phenyl]ethyl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 161431009 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | prop-2-enyl 4-methyl-2-[2-oxo-2-[4-(2-oxopropyl)phenyl]ethyl]-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(CC(=O)c2ccc(CC(C)=O)cc2)nc1C |
| InChI | InChI=1S/C19H19NO4S/c1-4-9-24-19(23)18-13(3)20-17(25-18)11-16(22)15-7-5-14(6-8-15)10-12(2)21/h4-8H,1,9-11H2,2-3H3 |
| InChIKey | VXZVVZDFFWAIBJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|