C17H18N2O3S — CID 110441503
prop-2-enyl 4-methyl-2-(3-phenylpropanoylamino)-1,3-thiazole-5-carboxylate (PubChem CID 110441503) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is prop-2-enyl 4-methyl-2-(3-phenylpropanoylamino)-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 4-methyl-2-(3-phenylpropanoylamino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 110441503 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | prop-2-enyl 4-methyl-2-(3-phenylpropanoylamino)-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(NC(=O)CCc2ccccc2)nc1C |
| InChI | InChI=1S/C17H18N2O3S/c1-3-11-22-16(21)15-12(2)18-17(23-15)19-14(20)10-9-13-7-5-4-6-8-13/h3-8H,1,9-11H2,2H3,(H,18,19,20) |
| InChIKey | HGLMHPOTSIYPRU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|