C11H14N2O3S — CID 110441292
prop-2-enyl 4-methyl-2-(propanoylamino)-1,3-thiazole-5-carboxylate (PubChem CID 110441292) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is prop-2-enyl 4-methyl-2-(propanoylamino)-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 4-methyl-2-(propanoylamino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 110441292 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | prop-2-enyl 4-methyl-2-(propanoylamino)-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(NC(=O)CC)nc1C |
| InChI | InChI=1S/C11H14N2O3S/c1-4-6-16-10(15)9-7(3)12-11(17-9)13-8(14)5-2/h4H,1,5-6H2,2-3H3,(H,12,13,14) |
| InChIKey | ZIYXQULXAWTGOR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|