C15H21N3O4S — CID 110446324
prop-2-enyl 4-methyl-2-(2-morpholin-4-ylpropanoylamino)-1,3-thiazole-5-carboxylate (PubChem CID 110446324) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is prop-2-enyl 4-methyl-2-(2-morpholin-4-ylpropanoylamino)-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 4-methyl-2-(2-morpholin-4-ylpropanoylamino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 110446324 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | prop-2-enyl 4-methyl-2-(2-morpholin-4-ylpropanoylamino)-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(NC(=O)C(C)N2CCOCC2)nc1C |
| InChI | InChI=1S/C15H21N3O4S/c1-4-7-22-14(20)12-10(2)16-15(23-12)17-13(19)11(3)18-5-8-21-9-6-18/h4,11H,1,5-9H2,2-3H3,(H,16,17,19) |
| InChIKey | WLYRGVNZLTZKDN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|