C17H18N2O4S — CID 3146511
prop-2-enyl 4-methyl-2-[[2-(3-methylphenoxy)acetyl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 3146511) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is prop-2-enyl 4-methyl-2-[[2-(3-methylphenoxy)acetyl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 4-methyl-2-[[2-(3-methylphenoxy)acetyl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 3146511 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | prop-2-enyl 4-methyl-2-[[2-(3-methylphenoxy)acetyl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(NC(=O)COc2cccc(C)c2)nc1C |
| InChI | InChI=1S/C17H18N2O4S/c1-4-8-22-16(21)15-12(3)18-17(24-15)19-14(20)10-23-13-7-5-6-11(2)9-13/h4-7,9H,1,8,10H2,2-3H3,(H,18,19,20) |
| InChIKey | MBVMZDITSRNLMY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|