C16H12Cl2N2O2S — CID 43988847
N-(4,7-dichloro-1,3-benzothiazol-2-yl)-2-(3-methylphenoxy)acetamide (PubChem CID 43988847) has the molecular formula C16H12Cl2N2O2S and a molecular weight of 367.26 g/mol. Its IUPAC name is N-(4,7-dichloro-1,3-benzothiazol-2-yl)-2-(3-methylphenoxy)acetamide.
| Compound Name | N-(4,7-dichloro-1,3-benzothiazol-2-yl)-2-(3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 43988847 |
| Molecular Formula | C16H12Cl2N2O2S |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | N-(4,7-dichloro-1,3-benzothiazol-2-yl)-2-(3-methylphenoxy)acetamide |
| SMILES | Cc1cccc(OCC(=O)Nc2nc3c(Cl)ccc(Cl)c3s2)c1 |
| InChI | InChI=1S/C16H12Cl2N2O2S/c1-9-3-2-4-10(7-9)22-8-13(21)19-16-20-14-11(17)5-6-12(18)15(14)23-16/h2-7H,8H2,1H3,(H,19,20,21) |
| InChIKey | PPORGBFVOQAFLJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |