C8H9NO2S — CID 142704119
prop-2-enyl 4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 142704119) has the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. Its IUPAC name is prop-2-enyl 4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 142704119 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | prop-2-enyl 4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1scnc1C |
| InChI | InChI=1S/C8H9NO2S/c1-3-4-11-8(10)7-6(2)9-5-12-7/h3,5H,1,4H2,2H3 |
| InChIKey | HOIMKYXRNDJWMA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|