C14H16N2O4 — CID 146258355
bis(prop-2-enyl) 3,6-dimethylpyrazine-2,5-dicarboxylate (PubChem CID 146258355) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is bis(prop-2-enyl) 3,6-dimethylpyrazine-2,5-dicarboxylate.
| Compound Name | bis(prop-2-enyl) 3,6-dimethylpyrazine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 146258355 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | bis(prop-2-enyl) 3,6-dimethylpyrazine-2,5-dicarboxylate |
| SMILES | C=CCOC(=O)c1nc(C)c(C(=O)OCC=C)nc1C |
| InChI | InChI=1S/C14H16N2O4/c1-5-7-19-13(17)11-9(3)16-12(10(4)15-11)14(18)20-8-6-2/h5-6H,1-2,7-8H2,3-4H3 |
| InChIKey | KJPUSYGIYXYWHR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|