C6H7N3O2S — CID 169098297
prop-2-enyl 5-sulfanylidene-1,2-dihydro-1,2,4-triazole-3-carboxylate (PubChem CID 169098297) has the molecular formula C6H7N3O2S and a molecular weight of 185.21 g/mol. Its IUPAC name is prop-2-enyl 5-sulfanylidene-1,2-dihydro-1,2,4-triazole-3-carboxylate.
| Compound Name | prop-2-enyl 5-sulfanylidene-1,2-dihydro-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 169098297 |
| Molecular Formula | C6H7N3O2S |
| Molecular Weight | 185.21 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | prop-2-enyl 5-sulfanylidene-1,2-dihydro-1,2,4-triazole-3-carboxylate |
| SMILES | C=CCOC(=O)c1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C6H7N3O2S/c1-2-3-11-5(10)4-7-6(12)9-8-4/h2H,1,3H2,(H2,7,8,9,12) |
| InChIKey | BZKTUDDIBHNREL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|