C14H14O4 — CID 8560
bis(prop-2-enyl) benzene-1,2-dicarboxylate (PubChem CID 8560) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is bis(prop-2-enyl) benzene-1,2-dicarboxylate.
| Compound Name | bis(prop-2-enyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 8560 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | bis(prop-2-enyl) benzene-1,2-dicarboxylate |
| SMILES | C=CCOC(=O)c1ccccc1C(=O)OCC=C |
| InChI | InChI=1S/C14H14O4/c1-3-9-17-13(15)11-7-5-6-8-12(11)14(16)18-10-4-2/h3-8H,1-2,9-10H2 |
| InChIKey | QUDWYFHPNIMBFC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|