C23H24O4 — CID 70559251
bis(prop-2-enyl) benzene-1,2-dicarboxylate;prop-2-enylbenzene (PubChem CID 70559251) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is bis(prop-2-enyl) benzene-1,2-dicarboxylate;prop-2-enylbenzene.
| Compound Name | bis(prop-2-enyl) benzene-1,2-dicarboxylate;prop-2-enylbenzene |
|---|---|
| PubChem CID | 70559251 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | bis(prop-2-enyl) benzene-1,2-dicarboxylate;prop-2-enylbenzene |
| SMILES | C=CCOC(=O)c1ccccc1C(=O)OCC=C.C=CCc1ccccc1 |
| InChI | InChI=1S/C14H14O4.C9H10/c1-3-9-17-13(15)11-7-5-6-8-12(11)14(16)18-10-4-2;1-2-6-9-7-4-3-5-8-9/h3-8H,1-2,9-10H2;2-5,7-8H,1,6H2 |
| InChIKey | BSYMUHOAKXNLEF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|