C16H19N3O5 — CID 174812366
bis(prop-2-enyl) benzene-1,2-dicarboxylate;formonitrile;urea (PubChem CID 174812366) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is bis(prop-2-enyl) benzene-1,2-dicarboxylate;formonitrile;urea.
| Compound Name | bis(prop-2-enyl) benzene-1,2-dicarboxylate;formonitrile;urea |
|---|---|
| PubChem CID | 174812366 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | bis(prop-2-enyl) benzene-1,2-dicarboxylate;formonitrile;urea |
| SMILES | C#N.C=CCOC(=O)c1ccccc1C(=O)OCC=C.NC(N)=O |
| InChI | InChI=1S/C14H14O4.CH4N2O.CHN/c1-3-9-17-13(15)11-7-5-6-8-12(11)14(16)18-10-4-2;2-1(3)4;1-2/h3-8H,1-2,9-10H2;(H4,2,3,4);1H |
| InChIKey | GYQUWIHSVWBZFM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 145.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|