About bis(prop-2-enyl) 2,3-bis(prop-2-enyl)benzene-1,4-dicarboxylate
bis(prop-2-enyl) 2,3-bis(prop-2-enyl)benzene-1,4-dicarboxylate (PubChem CID 18996410) has the molecular formula C20H22O4
and a molecular weight of 326.39 g/mol. Its IUPAC name is bis(prop-2-enyl) 2,3-bis(prop-2-enyl)benzene-1,4-dicarboxylate.
Molecular Properties
| Compound Name | bis(prop-2-enyl) 2,3-bis(prop-2-enyl)benzene-1,4-dicarboxylate |
| PubChem CID | 18996410 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | bis(prop-2-enyl) 2,3-bis(prop-2-enyl)benzene-1,4-dicarboxylate |
| SMILES | C=CCOC(=O)c1ccc(C(=O)OCC=C)c(CC=C)c1CC=C |
| InChI | InChI=1S/C20H22O4/c1-5-9-15-16(10-6-2)18(20(22)24-14-8-4)12-11-17(15)19(21)23-13-7-3/h5-8,11-12H,1-4,9-10,13-14H2 |
| InChIKey | KPKOLKKLVUQVJQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(prop-2-enyl) 2,3-bis(prop-2-enyl)benzene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(prop-2-enyl) 2,3-bis(prop-2-enyl)benzene-1,4-dicarboxylate?
The IUPAC name of bis(prop-2-enyl) 2,3-bis(prop-2-enyl)benzene-1,4-dicarboxylate (CID 18996410) is bis(prop-2-enyl) 2,3-bis(prop-2-enyl)benzene-1,4-dicarboxylate.
What is the SMILES notation for bis(prop-2-enyl) 2,3-bis(prop-2-enyl)benzene-1,4-dicarboxylate?
The canonical SMILES for bis(prop-2-enyl) 2,3-bis(prop-2-enyl)benzene-1,4-dicarboxylate is C=CCOC(=O)c1ccc(C(=O)OCC=C)c(CC=C)c1CC=C.
What is the InChIKey of bis(prop-2-enyl) 2,3-bis(prop-2-enyl)benzene-1,4-dicarboxylate?
The InChIKey is KPKOLKKLVUQVJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O4/c1-5-9-15-16(10-6-2)18(20(22)24-14-8-4)12-11-17(15)19(21)23-13-7-3/h5-8,11-12H,1-4,9-10,13-14H2.
What are the key properties of bis(prop-2-enyl) 2,3-bis(prop-2-enyl)benzene-1,4-dicarboxylate?
bis(prop-2-enyl) 2,3-bis(prop-2-enyl)benzene-1,4-dicarboxylate has a molecular weight of 326.39 g/mol, XLogP of 3.83, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(prop-2-enyl) 2,3-bis(prop-2-enyl)benzene-1,4-dicarboxylate is sourced from PubChem (CID 18996410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).