C22H18O8 — CID 139690927
4-(4-carboxy-3-prop-2-enoxycarbonylphenyl)-2-prop-2-enoxycarbonylbenzoic acid (PubChem CID 139690927) has the molecular formula C22H18O8 and a molecular weight of 410.38 g/mol. Its IUPAC name is 4-(4-carboxy-3-prop-2-enoxycarbonylphenyl)-2-prop-2-enoxycarbonylbenzoic acid.
| Compound Name | 4-(4-carboxy-3-prop-2-enoxycarbonylphenyl)-2-prop-2-enoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 139690927 |
| Molecular Formula | C22H18O8 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 4-(4-carboxy-3-prop-2-enoxycarbonylphenyl)-2-prop-2-enoxycarbonylbenzoic acid |
| SMILES | C=CCOC(=O)c1cc(-c2ccc(C(=O)O)c(C(=O)OCC=C)c2)ccc1C(=O)O |
| InChI | InChI=1S/C22H18O8/c1-3-9-29-21(27)17-11-13(5-7-15(17)19(23)24)14-6-8-16(20(25)26)18(12-14)22(28)30-10-4-2/h3-8,11-12H,1-2,9-10H2,(H,23,24)(H,25,26) |
| InChIKey | MZTQWPYINUCQHN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|