C19H14O9 — CID 67815012
4-(3-carboxy-4-prop-2-enoxycarbonylphenoxy)phthalic acid (PubChem CID 67815012) has the molecular formula C19H14O9 and a molecular weight of 386.31 g/mol. Its IUPAC name is 4-(3-carboxy-4-prop-2-enoxycarbonylphenoxy)phthalic acid.
| Compound Name | 4-(3-carboxy-4-prop-2-enoxycarbonylphenoxy)phthalic acid |
|---|---|
| PubChem CID | 67815012 |
| Molecular Formula | C19H14O9 |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 4-(3-carboxy-4-prop-2-enoxycarbonylphenoxy)phthalic acid |
| SMILES | C=CCOC(=O)c1ccc(Oc2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O |
| InChI | InChI=1S/C19H14O9/c1-2-7-27-19(26)13-6-4-11(9-15(13)18(24)25)28-10-3-5-12(16(20)21)14(8-10)17(22)23/h2-6,8-9H,1,7H2,(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | LGPTUYTZDAEJQF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|