C29H17NO15 — CID 67343205
4-[[2,6-bis(3,4-dicarboxyphenoxy)-4-pyridinyl]oxy]phthalic acid (PubChem CID 67343205) has the molecular formula C29H17NO15 and a molecular weight of 619.45 g/mol. Its IUPAC name is 4-[[2,6-bis(3,4-dicarboxyphenoxy)-4-pyridinyl]oxy]phthalic acid.
| Compound Name | 4-[[2,6-bis(3,4-dicarboxyphenoxy)-4-pyridinyl]oxy]phthalic acid |
|---|---|
| PubChem CID | 67343205 |
| Molecular Formula | C29H17NO15 |
| Molecular Weight | 619.45 g/mol |
| Exact Mass | 619.06 |
| IUPAC Name | 4-[[2,6-bis(3,4-dicarboxyphenoxy)-4-pyridinyl]oxy]phthalic acid |
| SMILES | O=C(O)c1ccc(Oc2cc(Oc3ccc(C(=O)O)c(C(=O)O)c3)nc(Oc3ccc(C(=O)O)c(C(=O)O)c3)c2)cc1C(=O)O |
| InChI | InChI=1S/C29H17NO15/c31-24(32)16-4-1-12(7-19(16)27(37)38)43-15-10-22(44-13-2-5-17(25(33)34)20(8-13)28(39)40)30-23(11-15)45-14-3-6-18(26(35)36)21(9-14)29(41)42/h1-11H,(H,31,32)(H,33,34)(H,35,36)(H,37,38)(H,39,40)(H,41,42) |
| InChIKey | UQEXWJWLXANMHD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 264.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |