About 4-boronooxyphthalic acid
4-boronooxyphthalic acid (PubChem CID 142763487) has the molecular formula C8H7BO7
and a molecular weight of 225.95 g/mol. Its IUPAC name is 4-boronooxyphthalic acid.
Molecular Properties
| Compound Name | 4-boronooxyphthalic acid |
| PubChem CID | 142763487 |
| Molecular Formula | C8H7BO7 |
| Molecular Weight | 225.95 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 4-boronooxyphthalic acid |
| SMILES | O=C(O)c1ccc(OB(O)O)cc1C(=O)O |
| InChI | InChI=1S/C8H7BO7/c10-7(11)5-2-1-4(16-9(14)15)3-6(5)8(12)13/h1-3,14-15H,(H,10,11)(H,12,13) |
| InChIKey | JARNKFOGTRMSFD-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.95 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-boronooxyphthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-boronooxyphthalic acid?
The IUPAC name of 4-boronooxyphthalic acid (CID 142763487) is 4-boronooxyphthalic acid.
What is the SMILES notation for 4-boronooxyphthalic acid?
The canonical SMILES for 4-boronooxyphthalic acid is O=C(O)c1ccc(OB(O)O)cc1C(=O)O.
What is the InChIKey of 4-boronooxyphthalic acid?
The InChIKey is JARNKFOGTRMSFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BO7/c10-7(11)5-2-1-4(16-9(14)15)3-6(5)8(12)13/h1-3,14-15H,(H,10,11)(H,12,13).
What are the key properties of 4-boronooxyphthalic acid?
4-boronooxyphthalic acid has a molecular weight of 225.95 g/mol, XLogP of -0.57, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-boronooxyphthalic acid is sourced from PubChem (CID 142763487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).