C28H20O10S — CID 69061581
1,1'-biphenyl;4-(3,4-dicarboxyphenoxy)sulfanyloxyphthalic acid (PubChem CID 69061581) has the molecular formula C28H20O10S and a molecular weight of 548.53 g/mol. Its IUPAC name is 1,1'-biphenyl;4-(3,4-dicarboxyphenoxy)sulfanyloxyphthalic acid.
| Compound Name | 1,1'-biphenyl;4-(3,4-dicarboxyphenoxy)sulfanyloxyphthalic acid |
|---|---|
| PubChem CID | 69061581 |
| Molecular Formula | C28H20O10S |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | 1,1'-biphenyl;4-(3,4-dicarboxyphenoxy)sulfanyloxyphthalic acid |
| SMILES | O=C(O)c1ccc(OSOc2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H10O10S.C12H10/c17-13(18)9-3-1-7(5-11(9)15(21)22)25-27-26-8-2-4-10(14(19)20)12(6-8)16(23)24;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-6H,(H,17,18)(H,19,20)(H,21,22)(H,23,24);1-10H |
| InChIKey | SHTBTLXWBBREBN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|