C28H20O10S — CID 23168447
4-[(3,4-dicarboxyphenoxy)-diphenyl-λ4-sulfanyl]oxyphthalic acid (PubChem CID 23168447) has the molecular formula C28H20O10S and a molecular weight of 548.53 g/mol. Its IUPAC name is 4-[(3,4-dicarboxyphenoxy)-diphenyl-λ4-sulfanyl]oxyphthalic acid.
| Compound Name | 4-[(3,4-dicarboxyphenoxy)-diphenyl-λ4-sulfanyl]oxyphthalic acid |
|---|---|
| PubChem CID | 23168447 |
| Molecular Formula | C28H20O10S |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | 4-[(3,4-dicarboxyphenoxy)-diphenyl-λ4-sulfanyl]oxyphthalic acid |
| SMILES | O=C(O)c1ccc(OS(Oc2ccc(C(=O)O)c(C(=O)O)c2)(c2ccccc2)c2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C28H20O10S/c29-25(30)21-13-11-17(15-23(21)27(33)34)37-39(19-7-3-1-4-8-19,20-9-5-2-6-10-20)38-18-12-14-22(26(31)32)24(16-18)28(35)36/h1-16H,(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | WGFNACFDUUILOP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |