About 4-cyanatophthalic acid
4-cyanatophthalic acid (PubChem CID 139964459) has the molecular formula C9H5NO5
and a molecular weight of 207.14 g/mol. Its IUPAC name is 4-cyanatophthalic acid.
Molecular Properties
| Compound Name | 4-cyanatophthalic acid |
| PubChem CID | 139964459 |
| Molecular Formula | C9H5NO5 |
| Molecular Weight | 207.14 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 4-cyanatophthalic acid |
| SMILES | N#COc1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C9H5NO5/c10-4-15-5-1-2-6(8(11)12)7(3-5)9(13)14/h1-3H,(H,11,12)(H,13,14) |
| InChIKey | HNBTTYKAPQSFBA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.14 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-cyanatophthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyanatophthalic acid?
The IUPAC name of 4-cyanatophthalic acid (CID 139964459) is 4-cyanatophthalic acid.
What is the SMILES notation for 4-cyanatophthalic acid?
The canonical SMILES for 4-cyanatophthalic acid is N#COc1ccc(C(=O)O)c(C(=O)O)c1.
What is the InChIKey of 4-cyanatophthalic acid?
The InChIKey is HNBTTYKAPQSFBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO5/c10-4-15-5-1-2-6(8(11)12)7(3-5)9(13)14/h1-3H,(H,11,12)(H,13,14).
What are the key properties of 4-cyanatophthalic acid?
4-cyanatophthalic acid has a molecular weight of 207.14 g/mol, XLogP of 0.94, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyanatophthalic acid is sourced from PubChem (CID 139964459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).