C9H5F3O7S — CID 87855598
4-(trifluoromethylsulfonyloxy)phthalic acid (PubChem CID 87855598) has the molecular formula C9H5F3O7S and a molecular weight of 314.19 g/mol. Its IUPAC name is 4-(trifluoromethylsulfonyloxy)phthalic acid.
| Compound Name | 4-(trifluoromethylsulfonyloxy)phthalic acid |
|---|---|
| PubChem CID | 87855598 |
| Molecular Formula | C9H5F3O7S |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | 4-(trifluoromethylsulfonyloxy)phthalic acid |
| SMILES | O=C(O)c1ccc(OS(=O)(=O)C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C9H5F3O7S/c10-9(11,12)20(17,18)19-4-1-2-5(7(13)14)6(3-4)8(15)16/h1-3H,(H,13,14)(H,15,16) |
| InChIKey | UCIXSLLFGHWAKP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|