C7H5F3O6S2 — CID 20671199
4-(trifluoromethylsulfonyloxy)benzenesulfonic acid (PubChem CID 20671199) has the molecular formula C7H5F3O6S2 and a molecular weight of 306.24 g/mol. Its IUPAC name is 4-(trifluoromethylsulfonyloxy)benzenesulfonic acid.
| Compound Name | 4-(trifluoromethylsulfonyloxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 20671199 |
| Molecular Formula | C7H5F3O6S2 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.95 |
| IUPAC Name | 4-(trifluoromethylsulfonyloxy)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C7H5F3O6S2/c8-7(9,10)18(14,15)16-5-1-3-6(4-2-5)17(11,12)13/h1-4H,(H,11,12,13) |
| InChIKey | JCERKUTUYDVQIV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|