C7H6BF3O5S — CID 101156352
[4-(trifluoromethylsulfonyloxy)phenyl]boronic acid (PubChem CID 101156352) has the molecular formula C7H6BF3O5S and a molecular weight of 269.99 g/mol. Its IUPAC name is [4-(trifluoromethylsulfonyloxy)phenyl]boronic acid.
| Compound Name | [4-(trifluoromethylsulfonyloxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 101156352 |
| Molecular Formula | C7H6BF3O5S |
| Molecular Weight | 269.99 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | [4-(trifluoromethylsulfonyloxy)phenyl]boronic acid |
| SMILES | O=S(=O)(Oc1ccc(B(O)O)cc1)C(F)(F)F |
| InChI | InChI=1S/C7H6BF3O5S/c9-7(10,11)17(14,15)16-6-3-1-5(2-4-6)8(12)13/h1-4,12-13H |
| InChIKey | YEGULWSPNIMFFB-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.99 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|