C9H3F9O9S3 — CID 19421193
[3,5-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate (PubChem CID 19421193) has the molecular formula C9H3F9O9S3 and a molecular weight of 522.30 g/mol. Its IUPAC name is [3,5-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 19421193 |
| Molecular Formula | C9H3F9O9S3 |
| Molecular Weight | 522.30 g/mol |
| Exact Mass | 521.88 |
| IUPAC Name | [3,5-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(OS(=O)(=O)C(F)(F)F)cc(OS(=O)(=O)C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C9H3F9O9S3/c10-7(11,12)28(19,20)25-4-1-5(26-29(21,22)8(13,14)15)3-6(2-4)27-30(23,24)9(16,17)18/h1-3H |
| InChIKey | BSDVKOXGJMVMKN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|