C9H8ClF3O3S — CID 135085815
(4-chloro-3,5-dimethylphenyl) trifluoromethanesulfonate (PubChem CID 135085815) has the molecular formula C9H8ClF3O3S and a molecular weight of 288.67 g/mol. Its IUPAC name is (4-chloro-3,5-dimethylphenyl) trifluoromethanesulfonate.
| Compound Name | (4-chloro-3,5-dimethylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135085815 |
| Molecular Formula | C9H8ClF3O3S |
| Molecular Weight | 288.67 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | (4-chloro-3,5-dimethylphenyl) trifluoromethanesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)C(F)(F)F)cc(C)c1Cl |
| InChI | InChI=1S/C9H8ClF3O3S/c1-5-3-7(4-6(2)8(5)10)16-17(14,15)9(11,12)13/h3-4H,1-2H3 |
| InChIKey | HEXWTFQGAAEVLL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.67 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|