About (3-chloro-2-ethylphenyl) trifluoromethanesulfonate
(3-chloro-2-ethylphenyl) trifluoromethanesulfonate (PubChem CID 86664497) has the molecular formula C9H8ClF3O3S
and a molecular weight of 288.67 g/mol. Its IUPAC name is (3-chloro-2-ethylphenyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (3-chloro-2-ethylphenyl) trifluoromethanesulfonate |
| PubChem CID | 86664497 |
| Molecular Formula | C9H8ClF3O3S |
| Molecular Weight | 288.67 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | (3-chloro-2-ethylphenyl) trifluoromethanesulfonate |
| SMILES | CCc1c(Cl)cccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H8ClF3O3S/c1-2-6-7(10)4-3-5-8(6)16-17(14,15)9(11,12)13/h3-5H,2H2,1H3 |
| InChIKey | QHJMSUKYKNCHGW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.67 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (3-chloro-2-ethylphenyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-2-ethylphenyl) trifluoromethanesulfonate?
The IUPAC name of (3-chloro-2-ethylphenyl) trifluoromethanesulfonate (CID 86664497) is (3-chloro-2-ethylphenyl) trifluoromethanesulfonate.
What is the SMILES notation for (3-chloro-2-ethylphenyl) trifluoromethanesulfonate?
The canonical SMILES for (3-chloro-2-ethylphenyl) trifluoromethanesulfonate is CCc1c(Cl)cccc1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of (3-chloro-2-ethylphenyl) trifluoromethanesulfonate?
The InChIKey is QHJMSUKYKNCHGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClF3O3S/c1-2-6-7(10)4-3-5-8(6)16-17(14,15)9(11,12)13/h3-5H,2H2,1H3.
What are the key properties of (3-chloro-2-ethylphenyl) trifluoromethanesulfonate?
(3-chloro-2-ethylphenyl) trifluoromethanesulfonate has a molecular weight of 288.67 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-2-ethylphenyl) trifluoromethanesulfonate is sourced from PubChem (CID 86664497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).