C15H19F3O3S — CID 135074384
[2-(4,5-dimethylhex-4-enyl)phenyl] trifluoromethanesulfonate (PubChem CID 135074384) has the molecular formula C15H19F3O3S and a molecular weight of 336.38 g/mol. Its IUPAC name is [2-(4,5-dimethylhex-4-enyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [2-(4,5-dimethylhex-4-enyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135074384 |
| Molecular Formula | C15H19F3O3S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | [2-(4,5-dimethylhex-4-enyl)phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)=C(C)CCCc1ccccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H19F3O3S/c1-11(2)12(3)7-6-9-13-8-4-5-10-14(13)21-22(19,20)15(16,17)18/h4-5,8,10H,6-7,9H2,1-3H3 |
| InChIKey | GCFCGSQYXGBBNC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|