C16H4F12O12S4 — CID 146535593
[3,6,7-tris(trifluoromethylsulfonyloxy)biphenylen-2-yl] trifluoromethanesulfonate (PubChem CID 146535593) has the molecular formula C16H4F12O12S4 and a molecular weight of 744.44 g/mol. Its IUPAC name is [3,6,7-tris(trifluoromethylsulfonyloxy)biphenylen-2-yl] trifluoromethanesulfonate.
| Compound Name | [3,6,7-tris(trifluoromethylsulfonyloxy)biphenylen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 146535593 |
| Molecular Formula | C16H4F12O12S4 |
| Molecular Weight | 744.44 g/mol |
| Exact Mass | 743.84 |
| IUPAC Name | [3,6,7-tris(trifluoromethylsulfonyloxy)biphenylen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc2c(cc1OS(=O)(=O)C(F)(F)F)-c1cc(OS(=O)(=O)C(F)(F)F)c(OS(=O)(=O)C(F)(F)F)cc1-2)C(F)(F)F |
| InChI | InChI=1S/C16H4F12O12S4/c17-13(18,19)41(29,30)37-9-1-5-6(2-10(9)38-42(31,32)14(20,21)22)8-4-12(40-44(35,36)16(26,27)28)11(3-7(5)8)39-43(33,34)15(23,24)25/h1-4H |
| InChIKey | JGWJSVBOJZBBEZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|