C14H20F6O6S2Si2 — CID 172787680
[3-(trifluoromethylsulfonyloxy)-2,5-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate (PubChem CID 172787680) has the molecular formula C14H20F6O6S2Si2 and a molecular weight of 518.60 g/mol. Its IUPAC name is [3-(trifluoromethylsulfonyloxy)-2,5-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [3-(trifluoromethylsulfonyloxy)-2,5-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 172787680 |
| Molecular Formula | C14H20F6O6S2Si2 |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.01 |
| IUPAC Name | [3-(trifluoromethylsulfonyloxy)-2,5-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)c1cc(OS(=O)(=O)C(F)(F)F)c([Si](C)(C)C)c(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C14H20F6O6S2Si2/c1-29(2,3)9-7-10(25-27(21,22)13(15,16)17)12(30(4,5)6)11(8-9)26-28(23,24)14(18,19)20/h7-8H,1-6H3 |
| InChIKey | PCVPQELYTKOTGS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|