C11H15F3O5SSi — CID 122231823
(5-hydroxy-3-methoxy-2-trimethylsilylphenyl) trifluoromethanesulfonate (PubChem CID 122231823) has the molecular formula C11H15F3O5SSi and a molecular weight of 344.38 g/mol. Its IUPAC name is (5-hydroxy-3-methoxy-2-trimethylsilylphenyl) trifluoromethanesulfonate.
| Compound Name | (5-hydroxy-3-methoxy-2-trimethylsilylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122231823 |
| Molecular Formula | C11H15F3O5SSi |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | (5-hydroxy-3-methoxy-2-trimethylsilylphenyl) trifluoromethanesulfonate |
| SMILES | COc1cc(O)cc(OS(=O)(=O)C(F)(F)F)c1[Si](C)(C)C |
| InChI | InChI=1S/C11H15F3O5SSi/c1-18-8-5-7(15)6-9(10(8)21(2,3)4)19-20(16,17)11(12,13)14/h5-6,15H,1-4H3 |
| InChIKey | VTYRUBCTYWYPJL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|