C13H21F3O3SSi2 — CID 56953950
[2,4-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate (PubChem CID 56953950) has the molecular formula C13H21F3O3SSi2 and a molecular weight of 370.54 g/mol. Its IUPAC name is [2,4-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [2,4-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 56953950 |
| Molecular Formula | C13H21F3O3SSi2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | [2,4-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)c1ccc(OS(=O)(=O)C(F)(F)F)c([Si](C)(C)C)c1 |
| InChI | InChI=1S/C13H21F3O3SSi2/c1-21(2,3)10-7-8-11(12(9-10)22(4,5)6)19-20(17,18)13(14,15)16/h7-9H,1-6H3 |
| InChIKey | NDYXFFDMRXBBCU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|