About (4-fluoro-2-iodophenyl) trifluoromethanesulfonate
(4-fluoro-2-iodophenyl) trifluoromethanesulfonate (PubChem CID 135038128) has the molecular formula C7H3F4IO3S
and a molecular weight of 370.06 g/mol. Its IUPAC name is (4-fluoro-2-iodophenyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (4-fluoro-2-iodophenyl) trifluoromethanesulfonate |
| PubChem CID | 135038128 |
| Molecular Formula | C7H3F4IO3S |
| Molecular Weight | 370.06 g/mol |
| Exact Mass | 369.88 |
| IUPAC Name | (4-fluoro-2-iodophenyl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(F)cc1I)C(F)(F)F |
| InChI | InChI=1S/C7H3F4IO3S/c8-4-1-2-6(5(12)3-4)15-16(13,14)7(9,10)11/h1-3H |
| InChIKey | MSDRWBCQMWZBFA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.06 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (4-fluoro-2-iodophenyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluoro-2-iodophenyl) trifluoromethanesulfonate?
The IUPAC name of (4-fluoro-2-iodophenyl) trifluoromethanesulfonate (CID 135038128) is (4-fluoro-2-iodophenyl) trifluoromethanesulfonate.
What is the SMILES notation for (4-fluoro-2-iodophenyl) trifluoromethanesulfonate?
The canonical SMILES for (4-fluoro-2-iodophenyl) trifluoromethanesulfonate is O=S(=O)(Oc1ccc(F)cc1I)C(F)(F)F.
What is the InChIKey of (4-fluoro-2-iodophenyl) trifluoromethanesulfonate?
The InChIKey is MSDRWBCQMWZBFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3F4IO3S/c8-4-1-2-6(5(12)3-4)15-16(13,14)7(9,10)11/h1-3H.
What are the key properties of (4-fluoro-2-iodophenyl) trifluoromethanesulfonate?
(4-fluoro-2-iodophenyl) trifluoromethanesulfonate has a molecular weight of 370.06 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluoro-2-iodophenyl) trifluoromethanesulfonate is sourced from PubChem (CID 135038128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).