C11H12F3IO3S — CID 121223682
(4-tert-butyl-2-iodophenyl) trifluoromethanesulfonate (PubChem CID 121223682) has the molecular formula C11H12F3IO3S and a molecular weight of 408.18 g/mol. Its IUPAC name is (4-tert-butyl-2-iodophenyl) trifluoromethanesulfonate.
| Compound Name | (4-tert-butyl-2-iodophenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 121223682 |
| Molecular Formula | C11H12F3IO3S |
| Molecular Weight | 408.18 g/mol |
| Exact Mass | 407.95 |
| IUPAC Name | (4-tert-butyl-2-iodophenyl) trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1ccc(OS(=O)(=O)C(F)(F)F)c(I)c1 |
| InChI | InChI=1S/C11H12F3IO3S/c1-10(2,3)7-4-5-9(8(15)6-7)18-19(16,17)11(12,13)14/h4-6H,1-3H3 |
| InChIKey | FSAUZMVBSRHLOO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.18 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|