C23H22F6O6S2 — CID 87583736
[2-[(Z)-prop-1-enyl]-4-[2-[3-[(Z)-prop-1-enyl]-4-(trifluoromethylsulfonyloxy)phenyl]propan-2-yl]phenyl] trifluoromethanesulfonate (PubChem CID 87583736) has the molecular formula C23H22F6O6S2 and a molecular weight of 572.55 g/mol. Its IUPAC name is [2-[(Z)-prop-1-enyl]-4-[2-[3-[(Z)-prop-1-enyl]-4-(trifluoromethylsulfonyloxy)phenyl]propan-2-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[(Z)-prop-1-enyl]-4-[2-[3-[(Z)-prop-1-enyl]-4-(trifluoromethylsulfonyloxy)phenyl]propan-2-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87583736 |
| Molecular Formula | C23H22F6O6S2 |
| Molecular Weight | 572.55 g/mol |
| Exact Mass | 572.08 |
| IUPAC Name | [2-[(Z)-prop-1-enyl]-4-[2-[3-[(Z)-prop-1-enyl]-4-(trifluoromethylsulfonyloxy)phenyl]propan-2-yl]phenyl] trifluoromethanesulfonate |
| SMILES | C/C=C\c1cc(C(C)(C)c2ccc(OS(=O)(=O)C(F)(F)F)c(/C=C\C)c2)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C23H22F6O6S2/c1-5-7-15-13-17(9-11-19(15)34-36(30,31)22(24,25)26)21(3,4)18-10-12-20(16(14-18)8-6-2)35-37(32,33)23(27,28)29/h5-14H,1-4H3/b7-5-,8-6- |
| InChIKey | GYMHVKIEUGTCBJ-SFECMWDFSA-N |
| XLogP | 6.54 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.55 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|