C21H28OS — CID 123724258
[2-ethenyl-4-(2-phenylpropan-2-yl)phenoxy]-ethyl-dimethyl-λ4-sulfane (PubChem CID 123724258) has the molecular formula C21H28OS and a molecular weight of 328.52 g/mol. Its IUPAC name is [2-ethenyl-4-(2-phenylpropan-2-yl)phenoxy]-ethyl-dimethyl-λ4-sulfane.
| Compound Name | [2-ethenyl-4-(2-phenylpropan-2-yl)phenoxy]-ethyl-dimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 123724258 |
| Molecular Formula | C21H28OS |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [2-ethenyl-4-(2-phenylpropan-2-yl)phenoxy]-ethyl-dimethyl-λ4-sulfane |
| SMILES | C=Cc1cc(C(C)(C)c2ccccc2)ccc1OS(C)(C)CC |
| InChI | InChI=1S/C21H28OS/c1-7-17-16-19(14-15-20(17)22-23(5,6)8-2)21(3,4)18-12-10-9-11-13-18/h7,9-16H,1,8H2,2-6H3 |
| InChIKey | XJVROPOHLJDCQF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |