C19H20O2 — CID 20820433
[2-methyl-4-(2-phenylpropan-2-yl)phenyl] prop-2-enoate (PubChem CID 20820433) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is [2-methyl-4-(2-phenylpropan-2-yl)phenyl] prop-2-enoate.
| Compound Name | [2-methyl-4-(2-phenylpropan-2-yl)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 20820433 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | [2-methyl-4-(2-phenylpropan-2-yl)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C(C)(C)c2ccccc2)cc1C |
| InChI | InChI=1S/C19H20O2/c1-5-18(20)21-17-12-11-16(13-14(17)2)19(3,4)15-9-7-6-8-10-15/h5-13H,1H2,2-4H3 |
| InChIKey | WFZWPYDKYJBGTI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|