About benzoic acid;(2-hydroxy-4-methylphenyl) prop-2-enoate
benzoic acid;(2-hydroxy-4-methylphenyl) prop-2-enoate (PubChem CID 174882954) has the molecular formula C17H16O5
and a molecular weight of 300.31 g/mol. Its IUPAC name is benzoic acid;(2-hydroxy-4-methylphenyl) prop-2-enoate.
Molecular Properties
| Compound Name | benzoic acid;(2-hydroxy-4-methylphenyl) prop-2-enoate |
| PubChem CID | 174882954 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | benzoic acid;(2-hydroxy-4-methylphenyl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C)cc1O.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C10H10O3.C7H6O2/c1-3-10(12)13-9-5-4-7(2)6-8(9)11;8-7(9)6-4-2-1-3-5-6/h3-6,11H,1H2,2H3;1-5H,(H,8,9) |
| InChIKey | ZRCBDVJXRFMGCA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;(2-hydroxy-4-methylphenyl) prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;(2-hydroxy-4-methylphenyl) prop-2-enoate?
The IUPAC name of benzoic acid;(2-hydroxy-4-methylphenyl) prop-2-enoate (CID 174882954) is benzoic acid;(2-hydroxy-4-methylphenyl) prop-2-enoate.
What is the SMILES notation for benzoic acid;(2-hydroxy-4-methylphenyl) prop-2-enoate?
The canonical SMILES for benzoic acid;(2-hydroxy-4-methylphenyl) prop-2-enoate is C=CC(=O)Oc1ccc(C)cc1O.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;(2-hydroxy-4-methylphenyl) prop-2-enoate?
The InChIKey is ZRCBDVJXRFMGCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3.C7H6O2/c1-3-10(12)13-9-5-4-7(2)6-8(9)11;8-7(9)6-4-2-1-3-5-6/h3-6,11H,1H2,2H3;1-5H,(H,8,9).
What are the key properties of benzoic acid;(2-hydroxy-4-methylphenyl) prop-2-enoate?
benzoic acid;(2-hydroxy-4-methylphenyl) prop-2-enoate has a molecular weight of 300.31 g/mol, XLogP of 3.18, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;(2-hydroxy-4-methylphenyl) prop-2-enoate is sourced from PubChem (CID 174882954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).