About benzoic acid;3-hydroxypropyl prop-2-enoate
benzoic acid;3-hydroxypropyl prop-2-enoate (PubChem CID 161094010) has the molecular formula C13H16O5
and a molecular weight of 252.27 g/mol. Its IUPAC name is benzoic acid;3-hydroxypropyl prop-2-enoate.
Molecular Properties
| Compound Name | benzoic acid;3-hydroxypropyl prop-2-enoate |
| PubChem CID | 161094010 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | benzoic acid;3-hydroxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCO.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C6H10O3/c8-7(9)6-4-2-1-3-5-6;1-2-6(8)9-5-3-4-7/h1-5H,(H,8,9);2,7H,1,3-5H2 |
| InChIKey | UHNYQOSYULALJU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;3-hydroxypropyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;3-hydroxypropyl prop-2-enoate?
The IUPAC name of benzoic acid;3-hydroxypropyl prop-2-enoate (CID 161094010) is benzoic acid;3-hydroxypropyl prop-2-enoate.
What is the SMILES notation for benzoic acid;3-hydroxypropyl prop-2-enoate?
The canonical SMILES for benzoic acid;3-hydroxypropyl prop-2-enoate is C=CC(=O)OCCCO.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;3-hydroxypropyl prop-2-enoate?
The InChIKey is UHNYQOSYULALJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C6H10O3/c8-7(9)6-4-2-1-3-5-6;1-2-6(8)9-5-3-4-7/h1-5H,(H,8,9);2,7H,1,3-5H2.
What are the key properties of benzoic acid;3-hydroxypropyl prop-2-enoate?
benzoic acid;3-hydroxypropyl prop-2-enoate has a molecular weight of 252.27 g/mol, XLogP of 1.48, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;3-hydroxypropyl prop-2-enoate is sourced from PubChem (CID 161094010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).