C18H24O7 — CID 91047100
(2-hydroxy-3-phenoxypropyl) prop-2-enoate;3-hydroxypropyl prop-2-enoate (PubChem CID 91047100) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is (2-hydroxy-3-phenoxypropyl) prop-2-enoate;3-hydroxypropyl prop-2-enoate.
| Compound Name | (2-hydroxy-3-phenoxypropyl) prop-2-enoate;3-hydroxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 91047100 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (2-hydroxy-3-phenoxypropyl) prop-2-enoate;3-hydroxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)COc1ccccc1.C=CC(=O)OCCCO |
| InChI | InChI=1S/C12H14O4.C6H10O3/c1-2-12(14)16-9-10(13)8-15-11-6-4-3-5-7-11;1-2-6(8)9-5-3-4-7/h2-7,10,13H,1,8-9H2;2,7H,1,3-5H2 |
| InChIKey | UVAYKHGGDAXKIK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|