C20H28O7 — CID 160827387
4-hydroxybutyl 2-methylprop-2-enoate;(2-hydroxy-3-phenoxypropyl) prop-2-enoate (PubChem CID 160827387) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-hydroxybutyl 2-methylprop-2-enoate;(2-hydroxy-3-phenoxypropyl) prop-2-enoate.
| Compound Name | 4-hydroxybutyl 2-methylprop-2-enoate;(2-hydroxy-3-phenoxypropyl) prop-2-enoate |
|---|---|
| PubChem CID | 160827387 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 4-hydroxybutyl 2-methylprop-2-enoate;(2-hydroxy-3-phenoxypropyl) prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCO.C=CC(=O)OCC(O)COc1ccccc1 |
| InChI | InChI=1S/C12H14O4.C8H14O3/c1-2-12(14)16-9-10(13)8-15-11-6-4-3-5-7-11;1-7(2)8(10)11-6-4-3-5-9/h2-7,10,13H,1,8-9H2;9H,1,3-6H2,2H3 |
| InChIKey | SGJADAKKHGEEKM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|