C27H40O6 — CID 91150847
(2-hydroxy-3-phenoxypropyl) prop-2-enoate;2-(phenoxymethyl)oxirane;propane (PubChem CID 91150847) has the molecular formula C27H40O6 and a molecular weight of 460.61 g/mol. Its IUPAC name is (2-hydroxy-3-phenoxypropyl) prop-2-enoate;2-(phenoxymethyl)oxirane;propane.
| Compound Name | (2-hydroxy-3-phenoxypropyl) prop-2-enoate;2-(phenoxymethyl)oxirane;propane |
|---|---|
| PubChem CID | 91150847 |
| Molecular Formula | C27H40O6 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | (2-hydroxy-3-phenoxypropyl) prop-2-enoate;2-(phenoxymethyl)oxirane;propane |
| SMILES | C=CC(=O)OCC(O)COc1ccccc1.CCC.CCC.c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C12H14O4.C9H10O2.2C3H8/c1-2-12(14)16-9-10(13)8-15-11-6-4-3-5-7-11;1-2-4-8(5-3-1)10-6-9-7-11-9;2*1-3-2/h2-7,10,13H,1,8-9H2;1-5,9H,6-7H2;2*3H2,1-2H3 |
| InChIKey | ULGWZAMLJLYAAZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|