About but-1-ene;2-(phenoxymethyl)oxirane
but-1-ene;2-(phenoxymethyl)oxirane (PubChem CID 142029605) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is but-1-ene;2-(phenoxymethyl)oxirane.
Molecular Properties
| Compound Name | but-1-ene;2-(phenoxymethyl)oxirane |
| PubChem CID | 142029605 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | but-1-ene;2-(phenoxymethyl)oxirane |
| SMILES | C=CCC.c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C9H10O2.C4H8/c1-2-4-8(5-3-1)10-6-9-7-11-9;1-3-4-2/h1-5,9H,6-7H2;3H,1,4H2,2H3 |
| InChIKey | UBVOCYRBQVXELZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;2-(phenoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;2-(phenoxymethyl)oxirane?
The IUPAC name of but-1-ene;2-(phenoxymethyl)oxirane (CID 142029605) is but-1-ene;2-(phenoxymethyl)oxirane.
What is the SMILES notation for but-1-ene;2-(phenoxymethyl)oxirane?
The canonical SMILES for but-1-ene;2-(phenoxymethyl)oxirane is C=CCC.c1ccc(OCC2CO2)cc1.
What is the InChIKey of but-1-ene;2-(phenoxymethyl)oxirane?
The InChIKey is UBVOCYRBQVXELZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.C4H8/c1-2-4-8(5-3-1)10-6-9-7-11-9;1-3-4-2/h1-5,9H,6-7H2;3H,1,4H2,2H3.
What are the key properties of but-1-ene;2-(phenoxymethyl)oxirane?
but-1-ene;2-(phenoxymethyl)oxirane has a molecular weight of 206.28 g/mol, XLogP of 3.05, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;2-(phenoxymethyl)oxirane is sourced from PubChem (CID 142029605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).