About ethene;2-(phenoxymethyl)oxirane
ethene;2-(phenoxymethyl)oxirane (PubChem CID 135283522) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is ethene;2-(phenoxymethyl)oxirane.
Molecular Properties
| Compound Name | ethene;2-(phenoxymethyl)oxirane |
| PubChem CID | 135283522 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | ethene;2-(phenoxymethyl)oxirane |
| SMILES | C=C.c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C9H10O2.C2H4/c1-2-4-8(5-3-1)10-6-9-7-11-9;1-2/h1-5,9H,6-7H2;1-2H2 |
| InChIKey | ZHXVFLXEIJSIOB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethene;2-(phenoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;2-(phenoxymethyl)oxirane?
The IUPAC name of ethene;2-(phenoxymethyl)oxirane (CID 135283522) is ethene;2-(phenoxymethyl)oxirane.
What is the SMILES notation for ethene;2-(phenoxymethyl)oxirane?
The canonical SMILES for ethene;2-(phenoxymethyl)oxirane is C=C.c1ccc(OCC2CO2)cc1.
What is the InChIKey of ethene;2-(phenoxymethyl)oxirane?
The InChIKey is ZHXVFLXEIJSIOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.C2H4/c1-2-4-8(5-3-1)10-6-9-7-11-9;1-2/h1-5,9H,6-7H2;1-2H2.
What are the key properties of ethene;2-(phenoxymethyl)oxirane?
ethene;2-(phenoxymethyl)oxirane has a molecular weight of 178.23 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;2-(phenoxymethyl)oxirane is sourced from PubChem (CID 135283522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).