About 7-oxabicyclo[4.1.0]heptane;2-(phenoxymethyl)oxirane
7-oxabicyclo[4.1.0]heptane;2-(phenoxymethyl)oxirane (PubChem CID 158637466) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]heptane;2-(phenoxymethyl)oxirane.
Molecular Properties
| Compound Name | 7-oxabicyclo[4.1.0]heptane;2-(phenoxymethyl)oxirane |
| PubChem CID | 158637466 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 7-oxabicyclo[4.1.0]heptane;2-(phenoxymethyl)oxirane |
| SMILES | C1CCC2OC2C1.c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C9H10O2.C6H10O/c1-2-4-8(5-3-1)10-6-9-7-11-9;1-2-4-6-5(3-1)7-6/h1-5,9H,6-7H2;5-6H,1-4H2 |
| InChIKey | HZYIZYHEPVBJJT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-oxabicyclo[4.1.0]heptane;2-(phenoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxabicyclo[4.1.0]heptane;2-(phenoxymethyl)oxirane?
The IUPAC name of 7-oxabicyclo[4.1.0]heptane;2-(phenoxymethyl)oxirane (CID 158637466) is 7-oxabicyclo[4.1.0]heptane;2-(phenoxymethyl)oxirane.
What is the SMILES notation for 7-oxabicyclo[4.1.0]heptane;2-(phenoxymethyl)oxirane?
The canonical SMILES for 7-oxabicyclo[4.1.0]heptane;2-(phenoxymethyl)oxirane is C1CCC2OC2C1.c1ccc(OCC2CO2)cc1.
What is the InChIKey of 7-oxabicyclo[4.1.0]heptane;2-(phenoxymethyl)oxirane?
The InChIKey is HZYIZYHEPVBJJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.C6H10O/c1-2-4-8(5-3-1)10-6-9-7-11-9;1-2-4-6-5(3-1)7-6/h1-5,9H,6-7H2;5-6H,1-4H2.
What are the key properties of 7-oxabicyclo[4.1.0]heptane;2-(phenoxymethyl)oxirane?
7-oxabicyclo[4.1.0]heptane;2-(phenoxymethyl)oxirane has a molecular weight of 248.32 g/mol, XLogP of 2.79, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxabicyclo[4.1.0]heptane;2-(phenoxymethyl)oxirane is sourced from PubChem (CID 158637466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).