C24H28O2 — CID 90797707
1,1'-biphenyl;2-(phenoxymethyl)oxirane;propane (PubChem CID 90797707) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 1,1'-biphenyl;2-(phenoxymethyl)oxirane;propane.
| Compound Name | 1,1'-biphenyl;2-(phenoxymethyl)oxirane;propane |
|---|---|
| PubChem CID | 90797707 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1,1'-biphenyl;2-(phenoxymethyl)oxirane;propane |
| SMILES | CCC.c1ccc(-c2ccccc2)cc1.c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C12H10.C9H10O2.C3H8/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-8(5-3-1)10-6-9-7-11-9;1-3-2/h1-10H;1-5,9H,6-7H2;3H2,1-2H3 |
| InChIKey | NNPSFNUNJSCRIQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|