About 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(2-(phenoxymethyl)oxirane)
1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(2-(phenoxymethyl)oxirane) (PubChem CID 161223554) has the molecular formula C35H42O4
and a molecular weight of 526.72 g/mol. Its IUPAC name is 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(2-(phenoxymethyl)oxirane).
Molecular Properties
| Compound Name | 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(2-(phenoxymethyl)oxirane) |
| PubChem CID | 161223554 |
| Molecular Formula | C35H42O4 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(2-(phenoxymethyl)oxirane) |
| SMILES | C.CCc1ccc(-c2ccc(CC)cc2)cc1.c1ccc(OCC2CO2)cc1.c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C16H18.2C9H10O2.CH4/c1-3-13-5-9-15(10-6-13)16-11-7-14(4-2)8-12-16;2*1-2-4-8(5-3-1)10-6-9-7-11-9;/h5-12H,3-4H2,1-2H3;2*1-5,9H,6-7H2;1H4 |
| InChIKey | UXVFSWYLMJQPRR-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(2-(phenoxymethyl)oxirane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(2-(phenoxymethyl)oxirane)?
The IUPAC name of 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(2-(phenoxymethyl)oxirane) (CID 161223554) is 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(2-(phenoxymethyl)oxirane).
What is the SMILES notation for 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(2-(phenoxymethyl)oxirane)?
The canonical SMILES for 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(2-(phenoxymethyl)oxirane) is C.CCc1ccc(-c2ccc(CC)cc2)cc1.c1ccc(OCC2CO2)cc1.c1ccc(OCC2CO2)cc1.
What is the InChIKey of 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(2-(phenoxymethyl)oxirane)?
The InChIKey is UXVFSWYLMJQPRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18.2C9H10O2.CH4/c1-3-13-5-9-15(10-6-13)16-11-7-14(4-2)8-12-16;2*1-2-4-8(5-3-1)10-6-9-7-11-9;/h5-12H,3-4H2,1-2H3;2*1-5,9H,6-7H2;1H4.
What are the key properties of 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(2-(phenoxymethyl)oxirane)?
1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(2-(phenoxymethyl)oxirane) has a molecular weight of 526.72 g/mol, XLogP of 8.04, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-(4-ethylphenyl)benzene;methane;bis(2-(phenoxymethyl)oxirane) is sourced from PubChem (CID 161223554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).